C15H41NO5SSi4 — CID 178068199
azanium 4-[2-tris(trimethylsilyloxy)silylethylsulfanyl]butanoate (PubChem CID 178068199) has the molecular formula C15H41NO5SSi4 and a molecular weight of 459.91 g/mol. Its IUPAC name is azanium 4-[2-tris(trimethylsilyloxy)silylethylsulfanyl]butanoate.
| Compound Name | azanium 4-[2-tris(trimethylsilyloxy)silylethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 178068199 |
| Molecular Formula | C15H41NO5SSi4 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | azanium 4-[2-tris(trimethylsilyloxy)silylethylsulfanyl]butanoate |
| SMILES | C[Si](C)(C)O[Si](CCSCCCC(=O)[O-])(O[Si](C)(C)C)O[Si](C)(C)C.[NH4+] |
| InChI | InChI=1S/C15H38O5SSi4.H3N/c1-22(2,3)18-25(19-23(4,5)6,20-24(7,8)9)14-13-21-12-10-11-15(16)17;/h10-14H2,1-9H3,(H,16,17);1H3 |
| InChIKey | KQIIXUNCCFMABM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|