C16H40O5SSi4 — CID 178068196
3-methyl-3-[2-tris(trimethylsilyloxy)silylethylsulfanyl]butanoic acid (PubChem CID 178068196) has the molecular formula C16H40O5SSi4 and a molecular weight of 456.90 g/mol. Its IUPAC name is 3-methyl-3-[2-tris(trimethylsilyloxy)silylethylsulfanyl]butanoic acid.
| Compound Name | 3-methyl-3-[2-tris(trimethylsilyloxy)silylethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 178068196 |
| Molecular Formula | C16H40O5SSi4 |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-methyl-3-[2-tris(trimethylsilyloxy)silylethylsulfanyl]butanoic acid |
| SMILES | CC(C)(CC(=O)O)SCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H40O5SSi4/c1-16(2,14-15(17)18)22-12-13-26(19-23(3,4)5,20-24(6,7)8)21-25(9,10)11/h12-14H2,1-11H3,(H,17,18) |
| InChIKey | PTZOPTCBXKXSJL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|