C17H34N2O5SSi — CID 162254681
1-butyl-3-methylimidazol-3-ium;3-(3-trimethoxysilylpropylsulfanyl)propanoate (PubChem CID 162254681) has the molecular formula C17H34N2O5SSi and a molecular weight of 406.62 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;3-(3-trimethoxysilylpropylsulfanyl)propanoate.
| Compound Name | 1-butyl-3-methylimidazol-3-ium;3-(3-trimethoxysilylpropylsulfanyl)propanoate |
|---|---|
| PubChem CID | 162254681 |
| Molecular Formula | C17H34N2O5SSi |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;3-(3-trimethoxysilylpropylsulfanyl)propanoate |
| SMILES | CCCCn1cc[n+](C)c1.CO[Si](CCCSCCC(=O)[O-])(OC)OC |
| InChI | InChI=1S/C9H20O5SSi.C8H15N2/c1-12-16(13-2,14-3)8-4-6-15-7-5-9(10)11;1-3-4-5-10-7-6-9(2)8-10/h4-8H2,1-3H3,(H,10,11);6-8H,3-5H2,1-2H3/q;+1/p-1 |
| InChIKey | ZYKZXYBZEFNEJU-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 76.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|