C17H36O6Si3 — CID 88503616
(E)-2-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]-3-propan-2-ylbut-2-enedioic acid (PubChem CID 88503616) has the molecular formula C17H36O6Si3 and a molecular weight of 420.73 g/mol. Its IUPAC name is (E)-2-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]-3-propan-2-ylbut-2-enedioic acid.
| Compound Name | (E)-2-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]-3-propan-2-ylbut-2-enedioic acid |
|---|---|
| PubChem CID | 88503616 |
| Molecular Formula | C17H36O6Si3 |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (E)-2-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]-3-propan-2-ylbut-2-enedioic acid |
| SMILES | CC(C)/C(C(=O)O)=C(/CCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C17H36O6Si3/c1-13(2)15(17(20)21)14(16(18)19)11-10-12-26(9,22-24(3,4)5)23-25(6,7)8/h13H,10-12H2,1-9H3,(H,18,19)(H,20,21)/b15-14+ |
| InChIKey | MXMXKZIWEXJKDJ-CCEZHUSRSA-N |
| XLogP | 4.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|