C13H28O4Si3 — CID 58210252
3-[methyl-bis(trimethylsilyloxy)silyl]propyl prop-2-ynoate (PubChem CID 58210252) has the molecular formula C13H28O4Si3 and a molecular weight of 332.62 g/mol. Its IUPAC name is 3-[methyl-bis(trimethylsilyloxy)silyl]propyl prop-2-ynoate.
| Compound Name | 3-[methyl-bis(trimethylsilyloxy)silyl]propyl prop-2-ynoate |
|---|---|
| PubChem CID | 58210252 |
| Molecular Formula | C13H28O4Si3 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-[methyl-bis(trimethylsilyloxy)silyl]propyl prop-2-ynoate |
| SMILES | C#CC(=O)OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28O4Si3/c1-9-13(14)15-11-10-12-20(8,16-18(2,3)4)17-19(5,6)7/h1H,10-12H2,2-8H3 |
| InChIKey | MWEWBOPUBCGJQP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|