About 6-prop-2-ynoyloxyhexyl prop-2-ynoate
6-prop-2-ynoyloxyhexyl prop-2-ynoate (PubChem CID 26794654) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 6-prop-2-ynoyloxyhexyl prop-2-ynoate.
Molecular Properties
| Compound Name | 6-prop-2-ynoyloxyhexyl prop-2-ynoate |
| PubChem CID | 26794654 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 6-prop-2-ynoyloxyhexyl prop-2-ynoate |
| SMILES | C#CC(=O)OCCCCCCOC(=O)C#C |
| InChI | InChI=1S/C12H14O4/c1-3-11(13)15-9-7-5-6-8-10-16-12(14)4-2/h1-2H,5-10H2 |
| InChIKey | WFUSVKDHSGOGNI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-ynoyloxyhexyl prop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-ynoyloxyhexyl prop-2-ynoate?
The IUPAC name of 6-prop-2-ynoyloxyhexyl prop-2-ynoate (CID 26794654) is 6-prop-2-ynoyloxyhexyl prop-2-ynoate.
What is the SMILES notation for 6-prop-2-ynoyloxyhexyl prop-2-ynoate?
The canonical SMILES for 6-prop-2-ynoyloxyhexyl prop-2-ynoate is C#CC(=O)OCCCCCCOC(=O)C#C.
What is the InChIKey of 6-prop-2-ynoyloxyhexyl prop-2-ynoate?
The InChIKey is WFUSVKDHSGOGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-3-11(13)15-9-7-5-6-8-10-16-12(14)4-2/h1-2H,5-10H2.
What are the key properties of 6-prop-2-ynoyloxyhexyl prop-2-ynoate?
6-prop-2-ynoyloxyhexyl prop-2-ynoate has a molecular weight of 222.24 g/mol, XLogP of 0.90, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-ynoyloxyhexyl prop-2-ynoate is sourced from PubChem (CID 26794654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).