C9H14O5 — CID 91515688
2-(2-hydroxyethyl)-3-propan-2-ylbut-2-enedioic acid (PubChem CID 91515688) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-3-propan-2-ylbut-2-enedioic acid.
| Compound Name | 2-(2-hydroxyethyl)-3-propan-2-ylbut-2-enedioic acid |
|---|---|
| PubChem CID | 91515688 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(2-hydroxyethyl)-3-propan-2-ylbut-2-enedioic acid |
| SMILES | CC(C)C(C(=O)O)=C(CCO)C(=O)O |
| InChI | InChI=1S/C9H14O5/c1-5(2)7(9(13)14)6(3-4-10)8(11)12/h5,10H,3-4H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | NLWLZAPJOFFVFS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|