C12H16O7 — CID 139922285
(Z)-2-(1-hydroxyethyl)-3-[2-(2-methylprop-2-enoyloxy)ethyl]but-2-enedioic acid (PubChem CID 139922285) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is (Z)-2-(1-hydroxyethyl)-3-[2-(2-methylprop-2-enoyloxy)ethyl]but-2-enedioic acid.
| Compound Name | (Z)-2-(1-hydroxyethyl)-3-[2-(2-methylprop-2-enoyloxy)ethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 139922285 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (Z)-2-(1-hydroxyethyl)-3-[2-(2-methylprop-2-enoyloxy)ethyl]but-2-enedioic acid |
| SMILES | C=C(C)C(=O)OCC/C(C(=O)O)=C(/C(=O)O)C(C)O |
| InChI | InChI=1S/C12H16O7/c1-6(2)12(18)19-5-4-8(10(14)15)9(7(3)13)11(16)17/h7,13H,1,4-5H2,2-3H3,(H,14,15)(H,16,17)/b9-8- |
| InChIKey | VAYODGBCNBUHMH-HJWRWDBZSA-N |
| XLogP | 0.34 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|