C9H19NO4 — CID 142490853
(2S)-3-(3-hydroxy-3-methylbutoxy)-2-(methylamino)propanoic acid (PubChem CID 142490853) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is (2S)-3-(3-hydroxy-3-methylbutoxy)-2-(methylamino)propanoic acid.
| Compound Name | (2S)-3-(3-hydroxy-3-methylbutoxy)-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 142490853 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (2S)-3-(3-hydroxy-3-methylbutoxy)-2-(methylamino)propanoic acid |
| SMILES | CN[C@@H](COCCC(C)(C)O)C(=O)O |
| InChI | InChI=1S/C9H19NO4/c1-9(2,13)4-5-14-6-7(10-3)8(11)12/h7,10,13H,4-6H2,1-3H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | YNKURYKQYPDSHX-ZETCQYMHSA-N |
| XLogP | -0.16 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|