C13H25NO7 — CID 147949232
(9S,10R,11R,12R)-3-amino-9,10,11,12,13-pentahydroxytridecane-2,6-dione (PubChem CID 147949232) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is (9S,10R,11R,12R)-3-amino-9,10,11,12,13-pentahydroxytridecane-2,6-dione.
| Compound Name | (9S,10R,11R,12R)-3-amino-9,10,11,12,13-pentahydroxytridecane-2,6-dione |
|---|---|
| PubChem CID | 147949232 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (9S,10R,11R,12R)-3-amino-9,10,11,12,13-pentahydroxytridecane-2,6-dione |
| SMILES | CC(=O)C(N)CCC(=O)CC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H25NO7/c1-7(16)9(14)4-2-8(17)3-5-10(18)12(20)13(21)11(19)6-15/h9-13,15,18-21H,2-6,14H2,1H3/t9?,10-,11+,12+,13+/m0/s1 |
| InChIKey | INHBMIDYJYLVRU-ONQCXXIWSA-N |
| XLogP | -2.53 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |