C12H23NO8 — CID 158149591
(8S,9R,10R,11R)-2-amino-8,9,10,11,12-pentahydroxy-5-oxododecanoic acid (PubChem CID 158149591) has the molecular formula C12H23NO8 and a molecular weight of 309.32 g/mol. Its IUPAC name is (8S,9R,10R,11R)-2-amino-8,9,10,11,12-pentahydroxy-5-oxododecanoic acid.
| Compound Name | (8S,9R,10R,11R)-2-amino-8,9,10,11,12-pentahydroxy-5-oxododecanoic acid |
|---|---|
| PubChem CID | 158149591 |
| Molecular Formula | C12H23NO8 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (8S,9R,10R,11R)-2-amino-8,9,10,11,12-pentahydroxy-5-oxododecanoic acid |
| SMILES | NC(CCC(=O)CC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C12H23NO8/c13-7(12(20)21)3-1-6(15)2-4-8(16)10(18)11(19)9(17)5-14/h7-11,14,16-19H,1-5,13H2,(H,20,21)/t7?,8-,9+,10+,11+/m0/s1 |
| InChIKey | FUYADJJEQWNDGO-DSNCZLQVSA-N |
| XLogP | -3.04 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |