C10H14O8 — CID 174871783
4,5,10,10-tetrahydroxydecane-2,3,7,8-tetrone (PubChem CID 174871783) has the molecular formula C10H14O8 and a molecular weight of 262.21 g/mol. Its IUPAC name is 4,5,10,10-tetrahydroxydecane-2,3,7,8-tetrone.
| Compound Name | 4,5,10,10-tetrahydroxydecane-2,3,7,8-tetrone |
|---|---|
| PubChem CID | 174871783 |
| Molecular Formula | C10H14O8 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4,5,10,10-tetrahydroxydecane-2,3,7,8-tetrone |
| SMILES | CC(=O)C(=O)C(O)C(O)CC(=O)C(=O)CC(O)O |
| InChI | InChI=1S/C10H14O8/c1-4(11)9(17)10(18)7(14)2-5(12)6(13)3-8(15)16/h7-8,10,14-16,18H,2-3H2,1H3 |
| InChIKey | IYRPOTHBGYYYLK-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|