C12H14O10 — CID 175242447
bis(2,3-dioxobutyl) 2,3-dihydroxybutanedioate (PubChem CID 175242447) has the molecular formula C12H14O10 and a molecular weight of 318.23 g/mol. Its IUPAC name is bis(2,3-dioxobutyl) 2,3-dihydroxybutanedioate.
| Compound Name | bis(2,3-dioxobutyl) 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 175242447 |
| Molecular Formula | C12H14O10 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | bis(2,3-dioxobutyl) 2,3-dihydroxybutanedioate |
| SMILES | CC(=O)C(=O)COC(=O)C(O)C(O)C(=O)OCC(=O)C(C)=O |
| InChI | InChI=1S/C12H14O10/c1-5(13)7(15)3-21-11(19)9(17)10(18)12(20)22-4-8(16)6(2)14/h9-10,17-18H,3-4H2,1-2H3 |
| InChIKey | SWVXHTOKGFPOBX-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|