C8H12O3 — CID 88902854
3-ethylidene-5-hydroxyhexane-2,4-dione (PubChem CID 88902854) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-ethylidene-5-hydroxyhexane-2,4-dione.
| Compound Name | 3-ethylidene-5-hydroxyhexane-2,4-dione |
|---|---|
| PubChem CID | 88902854 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 3-ethylidene-5-hydroxyhexane-2,4-dione |
| SMILES | CC=C(C(C)=O)C(=O)C(C)O |
| InChI | InChI=1S/C8H12O3/c1-4-7(5(2)9)8(11)6(3)10/h4,6,10H,1-3H3 |
| InChIKey | XJCGDYMEFGSFDC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|