C8H14N2O — CID 91362771
(E)-2-acetyl-N,N-dimethylbut-2-enimidamide (PubChem CID 91362771) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (E)-2-acetyl-N,N-dimethylbut-2-enimidamide.
| Compound Name | (E)-2-acetyl-N,N-dimethylbut-2-enimidamide |
|---|---|
| PubChem CID | 91362771 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (E)-2-acetyl-N,N-dimethylbut-2-enimidamide |
| SMILES | [H]/N=C(C(=C\C)/C(C)=O)\N(C)C |
| InChI | InChI=1S/C8H14N2O/c1-5-7(6(2)11)8(9)10(3)4/h5,9H,1-4H3/b7-5-,9-8- |
| InChIKey | AHMXWAWFKWYXFJ-PJHABFGRSA-N |
| XLogP | 1.06 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|