C6H10F3N3 — CID 154723464
N-[1-(dimethylamino)ethylidene]-2,2,2-trifluoroethanimidamide (PubChem CID 154723464) has the molecular formula C6H10F3N3 and a molecular weight of 181.16 g/mol. Its IUPAC name is N-[1-(dimethylamino)ethylidene]-2,2,2-trifluoroethanimidamide.
| Compound Name | N-[1-(dimethylamino)ethylidene]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 154723464 |
| Molecular Formula | C6H10F3N3 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | N-[1-(dimethylamino)ethylidene]-2,2,2-trifluoroethanimidamide |
| SMILES | [H]/N=C(\N=C(/C)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C6H10F3N3/c1-4(12(2)3)11-5(10)6(7,8)9/h10H,1-3H3/b10-5-,11-4+ |
| InChIKey | IILVVUSTAYRFBG-AOXYUYCMSA-N |
| XLogP | 1.51 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|