C7H15F3N6 — CID 144894450
N'-[N-amino-N-[2-(dimethylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide (PubChem CID 144894450) has the molecular formula C7H15F3N6 and a molecular weight of 240.23 g/mol. Its IUPAC name is N'-[N-amino-N-[2-(dimethylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-[N-amino-N-[2-(dimethylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 144894450 |
| Molecular Formula | C7H15F3N6 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N'-[N-amino-N-[2-(dimethylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide |
| SMILES | [H]/N=C(/N=C(\N)C(F)(F)F)N(N)CCN(C)C |
| InChI | InChI=1S/C7H15F3N6/c1-15(2)3-4-16(13)6(12)14-5(11)7(8,9)10/h3-4,13H2,1-2H3,(H3,11,12,14) |
| InChIKey | GMNJGCULCJKGRJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|