C8H19F3N6 — CID 144561758
N'-[N-amino-N-[2-(methylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide;ethane (PubChem CID 144561758) has the molecular formula C8H19F3N6 and a molecular weight of 256.28 g/mol. Its IUPAC name is N'-[N-amino-N-[2-(methylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide;ethane.
| Compound Name | N'-[N-amino-N-[2-(methylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide;ethane |
|---|---|
| PubChem CID | 144561758 |
| Molecular Formula | C8H19F3N6 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N'-[N-amino-N-[2-(methylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide;ethane |
| SMILES | CC.[H]/N=C(/N=C(\N)C(F)(F)F)N(N)CCNC |
| InChI | InChI=1S/C6H13F3N6.C2H6/c1-13-2-3-15(12)5(11)14-4(10)6(7,8)9;1-2/h13H,2-3,12H2,1H3,(H3,10,11,14);1-2H3 |
| InChIKey | LNIYLKMBUKGQEZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|