C6H13F3N6 — CID 144561759
N'-[N-amino-N-[2-(methylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide (PubChem CID 144561759) has the molecular formula C6H13F3N6 and a molecular weight of 226.21 g/mol. Its IUPAC name is N'-[N-amino-N-[2-(methylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-[N-amino-N-[2-(methylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 144561759 |
| Molecular Formula | C6H13F3N6 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N'-[N-amino-N-[2-(methylamino)ethyl]carbamimidoyl]-2,2,2-trifluoroethanimidamide |
| SMILES | [H]/N=C(/N=C(\N)C(F)(F)F)N(N)CCNC |
| InChI | InChI=1S/C6H13F3N6/c1-13-2-3-15(12)5(11)14-4(10)6(7,8)9/h13H,2-3,12H2,1H3,(H3,10,11,14) |
| InChIKey | WHKHJGBXWSQWBG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|