C7H14F3N5 — CID 144561771
N'-[N-amino-N-(2-methylpropyl)carbamimidoyl]-2,2,2-trifluoroethanimidamide (PubChem CID 144561771) has the molecular formula C7H14F3N5 and a molecular weight of 225.22 g/mol. Its IUPAC name is N'-[N-amino-N-(2-methylpropyl)carbamimidoyl]-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-[N-amino-N-(2-methylpropyl)carbamimidoyl]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 144561771 |
| Molecular Formula | C7H14F3N5 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N'-[N-amino-N-(2-methylpropyl)carbamimidoyl]-2,2,2-trifluoroethanimidamide |
| SMILES | [H]/N=C(/N=C(\N)C(F)(F)F)N(N)CC(C)C |
| InChI | InChI=1S/C7H14F3N5/c1-4(2)3-15(13)6(12)14-5(11)7(8,9)10/h4H,3,13H2,1-2H3,(H3,11,12,14) |
| InChIKey | HNHMLAIGTFREDW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|