C9H20F3N5 — CID 144561770
N'-[N-amino-N-(2-methylpropyl)carbamimidoyl]-2,2,2-trifluoroethanimidamide;ethane (PubChem CID 144561770) has the molecular formula C9H20F3N5 and a molecular weight of 255.29 g/mol. Its IUPAC name is N'-[N-amino-N-(2-methylpropyl)carbamimidoyl]-2,2,2-trifluoroethanimidamide;ethane.
| Compound Name | N'-[N-amino-N-(2-methylpropyl)carbamimidoyl]-2,2,2-trifluoroethanimidamide;ethane |
|---|---|
| PubChem CID | 144561770 |
| Molecular Formula | C9H20F3N5 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N'-[N-amino-N-(2-methylpropyl)carbamimidoyl]-2,2,2-trifluoroethanimidamide;ethane |
| SMILES | CC.[H]/N=C(/N=C(\N)C(F)(F)F)N(N)CC(C)C |
| InChI | InChI=1S/C7H14F3N5.C2H6/c1-4(2)3-15(13)6(12)14-5(11)7(8,9)10;1-2/h4H,3,13H2,1-2H3,(H3,11,12,14);1-2H3 |
| InChIKey | JMNKMBUXVKLBNB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|