C8H22N6 — CID 144561806
1-amino-3-(diaminomethylidene)-1-(2-methylpropyl)guanidine;ethane (PubChem CID 144561806) has the molecular formula C8H22N6 and a molecular weight of 202.31 g/mol. Its IUPAC name is 1-amino-3-(diaminomethylidene)-1-(2-methylpropyl)guanidine;ethane.
| Compound Name | 1-amino-3-(diaminomethylidene)-1-(2-methylpropyl)guanidine;ethane |
|---|---|
| PubChem CID | 144561806 |
| Molecular Formula | C8H22N6 |
| Molecular Weight | 202.31 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 1-amino-3-(diaminomethylidene)-1-(2-methylpropyl)guanidine;ethane |
| SMILES | CC.[H]/N=C(\N=C(N)N)N(N)CC(C)C |
| InChI | InChI=1S/C6H16N6.C2H6/c1-4(2)3-12(10)6(9)11-5(7)8;1-2/h4H,3,10H2,1-2H3,(H5,7,8,9,11);1-2H3 |
| InChIKey | CDINOBFVBSKZHE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|