C12H25N3 — CID 167052160
N-[1-(dimethylamino)-2,2-dimethylpropylidene]-2,2-dimethylpropanimidamide (PubChem CID 167052160) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is N-[1-(dimethylamino)-2,2-dimethylpropylidene]-2,2-dimethylpropanimidamide.
| Compound Name | N-[1-(dimethylamino)-2,2-dimethylpropylidene]-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 167052160 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | N-[1-(dimethylamino)-2,2-dimethylpropylidene]-2,2-dimethylpropanimidamide |
| SMILES | [H]/N=C(/N=C(\N(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H25N3/c1-11(2,3)9(13)14-10(15(7)8)12(4,5)6/h13H,1-8H3/b13-9+,14-10- |
| InChIKey | XVOWTNDIKVPWGY-ITAGJCAXSA-N |
| XLogP | 3.02 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|