dichlorocadmium;2-hydroxypropanoic acid

C3H6CdCl2O3 — CID 175553324

IUPACdichlorocadmium;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.Cl[Cd]Cl
InChIInChI=1S/C3H6O3.Cd.2ClH/c1-2(4)3(5)6;;;/h2,4H,1H3,(H,5,6);;2*1H/q;+2;;/p-2
InChIKeyOUBZYIKWMURVKQ-UHFFFAOYSA-L
MW273.40 g/mol
LogP0.83
Rot. Bonds1

About dichlorocadmium;2-hydroxypropanoic acid

dichlorocadmium;2-hydroxypropanoic acid (PubChem CID 175553324) has the molecular formula C3H6CdCl2O3 and a molecular weight of 273.40 g/mol. Its IUPAC name is dichlorocadmium;2-hydroxypropanoic acid.

Molecular Properties

Compound Namedichlorocadmium;2-hydroxypropanoic acid
PubChem CID175553324
Molecular FormulaC3H6CdCl2O3
Molecular Weight273.40 g/mol
Exact Mass273.87
IUPAC Namedichlorocadmium;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.Cl[Cd]Cl
InChIInChI=1S/C3H6O3.Cd.2ClH/c1-2(4)3(5)6;;;/h2,4H,1H3,(H,5,6);;2*1H/q;+2;;/p-2
InChIKeyOUBZYIKWMURVKQ-UHFFFAOYSA-L
XLogP0.83
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.40
LogP ≤ 50.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze dichlorocadmium;2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dichlorocadmium;2-hydroxypropanoic acid?
The IUPAC name of dichlorocadmium;2-hydroxypropanoic acid (CID 175553324) is dichlorocadmium;2-hydroxypropanoic acid.
What is the SMILES notation for dichlorocadmium;2-hydroxypropanoic acid?
The canonical SMILES for dichlorocadmium;2-hydroxypropanoic acid is CC(O)C(=O)O.Cl[Cd]Cl.
What is the InChIKey of dichlorocadmium;2-hydroxypropanoic acid?
The InChIKey is OUBZYIKWMURVKQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6O3.Cd.2ClH/c1-2(4)3(5)6;;;/h2,4H,1H3,(H,5,6);;2*1H/q;+2;;/p-2.
What are the key properties of dichlorocadmium;2-hydroxypropanoic acid?
dichlorocadmium;2-hydroxypropanoic acid has a molecular weight of 273.40 g/mol, XLogP of 0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocadmium;2-hydroxypropanoic acid is sourced from PubChem (CID 175553324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).