C9H20N6O3 — CID 91506149
hexane-1,1,6-tricarbohydrazide (PubChem CID 91506149) has the molecular formula C9H20N6O3 and a molecular weight of 260.30 g/mol. Its IUPAC name is hexane-1,1,6-tricarbohydrazide.
| Compound Name | hexane-1,1,6-tricarbohydrazide |
|---|---|
| PubChem CID | 91506149 |
| Molecular Formula | C9H20N6O3 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | hexane-1,1,6-tricarbohydrazide |
| SMILES | NNC(=O)CCCCCC(C(=O)NN)C(=O)NN |
| InChI | InChI=1S/C9H20N6O3/c10-13-7(16)5-3-1-2-4-6(8(17)14-11)9(18)15-12/h6H,1-5,10-12H2,(H,13,16)(H,14,17)(H,15,18) |
| InChIKey | XMKBUNAXPDZXKA-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|