C11H24N8O4 — CID 102254875
(3R,5S)-heptane-1,3,5,7-tetracarbohydrazide (PubChem CID 102254875) has the molecular formula C11H24N8O4 and a molecular weight of 332.37 g/mol. Its IUPAC name is (3R,5S)-heptane-1,3,5,7-tetracarbohydrazide.
| Compound Name | (3R,5S)-heptane-1,3,5,7-tetracarbohydrazide |
|---|---|
| PubChem CID | 102254875 |
| Molecular Formula | C11H24N8O4 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (3R,5S)-heptane-1,3,5,7-tetracarbohydrazide |
| SMILES | NNC(=O)CC[C@H](C[C@H](CCC(=O)NN)C(=O)NN)C(=O)NN |
| InChI | InChI=1S/C11H24N8O4/c12-16-8(20)3-1-6(10(22)18-14)5-7(11(23)19-15)2-4-9(21)17-13/h6-7H,1-5,12-15H2,(H,16,20)(H,17,21)(H,18,22)(H,19,23)/t6-,7+ |
| InChIKey | AIYWDDZUTOYWEG-KNVOCYPGSA-N |
| XLogP | -3.87 |
| TPSA | 220.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|