C12H26N4O4 — CID 3100698
2-(3-butoxy-2-hydroxypropyl)pentanedihydrazide (PubChem CID 3100698) has the molecular formula C12H26N4O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(3-butoxy-2-hydroxypropyl)pentanedihydrazide.
| Compound Name | 2-(3-butoxy-2-hydroxypropyl)pentanedihydrazide |
|---|---|
| PubChem CID | 3100698 |
| Molecular Formula | C12H26N4O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-(3-butoxy-2-hydroxypropyl)pentanedihydrazide |
| SMILES | CCCCOCC(O)CC(CCC(=O)NN)C(=O)NN |
| InChI | InChI=1S/C12H26N4O4/c1-2-3-6-20-8-10(17)7-9(12(19)16-14)4-5-11(18)15-13/h9-10,17H,2-8,13-14H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | ZFXMKUOGZVVUQG-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|