C19H30N2O7 — CID 128963437
2-benzyl-4-hydroxy-5-(3-methylbutoxy)pentanehydrazide;oxalic acid (PubChem CID 128963437) has the molecular formula C19H30N2O7 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-benzyl-4-hydroxy-5-(3-methylbutoxy)pentanehydrazide;oxalic acid.
| Compound Name | 2-benzyl-4-hydroxy-5-(3-methylbutoxy)pentanehydrazide;oxalic acid |
|---|---|
| PubChem CID | 128963437 |
| Molecular Formula | C19H30N2O7 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-benzyl-4-hydroxy-5-(3-methylbutoxy)pentanehydrazide;oxalic acid |
| SMILES | CC(C)CCOCC(O)CC(Cc1ccccc1)C(=O)NN.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H28N2O3.C2H2O4/c1-13(2)8-9-22-12-16(20)11-15(17(21)19-18)10-14-6-4-3-5-7-14;3-1(4)2(5)6/h3-7,13,15-16,20H,8-12,18H2,1-2H3,(H,19,21);(H,3,4)(H,5,6) |
| InChIKey | VBOMCRYSQUNNNG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|