C27H52N4O4 — CID 102254878
(3R,5S)-1-N,3-N,5-N,7-N-tetrakis(2-methylpropyl)heptane-1,3,5,7-tetracarboxamide (PubChem CID 102254878) has the molecular formula C27H52N4O4 and a molecular weight of 496.74 g/mol. Its IUPAC name is (3R,5S)-1-N,3-N,5-N,7-N-tetrakis(2-methylpropyl)heptane-1,3,5,7-tetracarboxamide.
| Compound Name | (3R,5S)-1-N,3-N,5-N,7-N-tetrakis(2-methylpropyl)heptane-1,3,5,7-tetracarboxamide |
|---|---|
| PubChem CID | 102254878 |
| Molecular Formula | C27H52N4O4 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.40 |
| IUPAC Name | (3R,5S)-1-N,3-N,5-N,7-N-tetrakis(2-methylpropyl)heptane-1,3,5,7-tetracarboxamide |
| SMILES | CC(C)CNC(=O)CC[C@H](C[C@H](CCC(=O)NCC(C)C)C(=O)NCC(C)C)C(=O)NCC(C)C |
| InChI | InChI=1S/C27H52N4O4/c1-18(2)14-28-24(32)11-9-22(26(34)30-16-20(5)6)13-23(27(35)31-17-21(7)8)10-12-25(33)29-15-19(3)4/h18-23H,9-17H2,1-8H3,(H,28,32)(H,29,33)(H,30,34)(H,31,35)/t22-,23+ |
| InChIKey | YBXWLZHSYUCPHY-ZRZAMGCNSA-N |
| XLogP | 3.26 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |