C11H24N4O4 — CID 3743875
2-(2-hydroxy-3-propan-2-yloxypropyl)pentanedihydrazide (PubChem CID 3743875) has the molecular formula C11H24N4O4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(2-hydroxy-3-propan-2-yloxypropyl)pentanedihydrazide.
| Compound Name | 2-(2-hydroxy-3-propan-2-yloxypropyl)pentanedihydrazide |
|---|---|
| PubChem CID | 3743875 |
| Molecular Formula | C11H24N4O4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-(2-hydroxy-3-propan-2-yloxypropyl)pentanedihydrazide |
| SMILES | CC(C)OCC(O)CC(CCC(=O)NN)C(=O)NN |
| InChI | InChI=1S/C11H24N4O4/c1-7(2)19-6-9(16)5-8(11(18)15-13)3-4-10(17)14-12/h7-9,16H,3-6,12-13H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | SDQOUUBRWSSTRL-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|