C10H22N6O3 — CID 91008212
heptane-1,1,7-tricarbohydrazide (PubChem CID 91008212) has the molecular formula C10H22N6O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is heptane-1,1,7-tricarbohydrazide.
| Compound Name | heptane-1,1,7-tricarbohydrazide |
|---|---|
| PubChem CID | 91008212 |
| Molecular Formula | C10H22N6O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | heptane-1,1,7-tricarbohydrazide |
| SMILES | NNC(=O)CCCCCCC(C(=O)NN)C(=O)NN |
| InChI | InChI=1S/C10H22N6O3/c11-14-8(17)6-4-2-1-3-5-7(9(18)15-12)10(19)16-13/h7H,1-6,11-13H2,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | RGUMNUDFEYFVNR-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|