C10H18N4O4 — CID 176897960
3,8-dioxodecanedihydrazide (PubChem CID 176897960) has the molecular formula C10H18N4O4 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3,8-dioxodecanedihydrazide.
| Compound Name | 3,8-dioxodecanedihydrazide |
|---|---|
| PubChem CID | 176897960 |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 3,8-dioxodecanedihydrazide |
| SMILES | NNC(=O)CC(=O)CCCCC(=O)CC(=O)NN |
| InChI | InChI=1S/C10H18N4O4/c11-13-9(17)5-7(15)3-1-2-4-8(16)6-10(18)14-12/h1-6,11-12H2,(H,13,17)(H,14,18) |
| InChIKey | WEZHZWGUGGTSPW-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|