C11H18Cl2O2 — CID 154391115
1,11-dichloroundecane-5,7-dione (PubChem CID 154391115) has the molecular formula C11H18Cl2O2 and a molecular weight of 253.17 g/mol. Its IUPAC name is 1,11-dichloroundecane-5,7-dione.
| Compound Name | 1,11-dichloroundecane-5,7-dione |
|---|---|
| PubChem CID | 154391115 |
| Molecular Formula | C11H18Cl2O2 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1,11-dichloroundecane-5,7-dione |
| SMILES | O=C(CCCCCl)CC(=O)CCCCCl |
| InChI | InChI=1S/C11H18Cl2O2/c12-7-3-1-5-10(14)9-11(15)6-2-4-8-13/h1-9H2 |
| InChIKey | QHRDBQVJRNFMHZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|