C10H16Cl2O2 — CID 57043927
1,10-dichlorodecane-3,8-dione (PubChem CID 57043927) has the molecular formula C10H16Cl2O2 and a molecular weight of 239.14 g/mol. Its IUPAC name is 1,10-dichlorodecane-3,8-dione.
| Compound Name | 1,10-dichlorodecane-3,8-dione |
|---|---|
| PubChem CID | 57043927 |
| Molecular Formula | C10H16Cl2O2 |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1,10-dichlorodecane-3,8-dione |
| SMILES | O=C(CCCl)CCCCC(=O)CCCl |
| InChI | InChI=1S/C10H16Cl2O2/c11-7-5-9(13)3-1-2-4-10(14)6-8-12/h1-8H2 |
| InChIKey | AYSJKUMYIJFXHR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|