About 7-chloro-3-oxoheptanoic acid
7-chloro-3-oxoheptanoic acid (PubChem CID 22488478) has the molecular formula C7H11ClO3
and a molecular weight of 178.61 g/mol. Its IUPAC name is 7-chloro-3-oxoheptanoic acid.
Molecular Properties
| Compound Name | 7-chloro-3-oxoheptanoic acid |
| PubChem CID | 22488478 |
| Molecular Formula | C7H11ClO3 |
| Molecular Weight | 178.61 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 7-chloro-3-oxoheptanoic acid |
| SMILES | O=C(O)CC(=O)CCCCCl |
| InChI | InChI=1S/C7H11ClO3/c8-4-2-1-3-6(9)5-7(10)11/h1-5H2,(H,10,11) |
| InChIKey | SJVBCAWRIAKUOU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.61 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-oxoheptanoic acid?
The IUPAC name of 7-chloro-3-oxoheptanoic acid (CID 22488478) is 7-chloro-3-oxoheptanoic acid.
What is the SMILES notation for 7-chloro-3-oxoheptanoic acid?
The canonical SMILES for 7-chloro-3-oxoheptanoic acid is O=C(O)CC(=O)CCCCCl.
What is the InChIKey of 7-chloro-3-oxoheptanoic acid?
The InChIKey is SJVBCAWRIAKUOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO3/c8-4-2-1-3-6(9)5-7(10)11/h1-5H2,(H,10,11).
What are the key properties of 7-chloro-3-oxoheptanoic acid?
7-chloro-3-oxoheptanoic acid has a molecular weight of 178.61 g/mol, XLogP of 1.44, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-oxoheptanoic acid is sourced from PubChem (CID 22488478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).