About 7-chloroheptanoic acid
7-chloroheptanoic acid (PubChem CID 13188) has the molecular formula C7H13ClO2
and a molecular weight of 164.63 g/mol. Its IUPAC name is 7-chloroheptanoic acid.
Molecular Properties
| Compound Name | 7-chloroheptanoic acid |
| PubChem CID | 13188 |
| Molecular Formula | C7H13ClO2 |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 7-chloroheptanoic acid |
| SMILES | O=C(O)CCCCCCCl |
| InChI | InChI=1S/C7H13ClO2/c8-6-4-2-1-3-5-7(9)10/h1-6H2,(H,9,10) |
| InChIKey | IGNBKLCFKTYIRI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-chloroheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloroheptanoic acid?
The IUPAC name of 7-chloroheptanoic acid (CID 13188) is 7-chloroheptanoic acid.
What is the SMILES notation for 7-chloroheptanoic acid?
The canonical SMILES for 7-chloroheptanoic acid is O=C(O)CCCCCCCl.
What is the InChIKey of 7-chloroheptanoic acid?
The InChIKey is IGNBKLCFKTYIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO2/c8-6-4-2-1-3-5-7(9)10/h1-6H2,(H,9,10).
What are the key properties of 7-chloroheptanoic acid?
7-chloroheptanoic acid has a molecular weight of 164.63 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloroheptanoic acid is sourced from PubChem (CID 13188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).