C38H38N4O6 — CID 175112992
1-N,1-N',10-N,10-N'-tetrabenzoyldecanedihydrazide (PubChem CID 175112992) has the molecular formula C38H38N4O6 and a molecular weight of 646.74 g/mol. Its IUPAC name is 1-N,1-N',10-N,10-N'-tetrabenzoyldecanedihydrazide.
| Compound Name | 1-N,1-N',10-N,10-N'-tetrabenzoyldecanedihydrazide |
|---|---|
| PubChem CID | 175112992 |
| Molecular Formula | C38H38N4O6 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 1-N,1-N',10-N,10-N'-tetrabenzoyldecanedihydrazide |
| SMILES | O=C(NN(C(=O)CCCCCCCCC(=O)N(NC(=O)c1ccccc1)C(=O)c1ccccc1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H38N4O6/c43-33(41(37(47)31-23-13-7-14-24-31)39-35(45)29-19-9-5-10-20-29)27-17-3-1-2-4-18-28-34(44)42(38(48)32-25-15-8-16-26-32)40-36(46)30-21-11-6-12-22-30/h5-16,19-26H,1-4,17-18,27-28H2,(H,39,45)(H,40,46) |
| InChIKey | NNIWRVUQICJKAT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|