C30H35N3O3 — CID 4208785
N-[4-[benzamido(phenyl)carbamoyl]phenyl]decanamide (PubChem CID 4208785) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[4-[benzamido(phenyl)carbamoyl]phenyl]decanamide.
| Compound Name | N-[4-[benzamido(phenyl)carbamoyl]phenyl]decanamide |
|---|---|
| PubChem CID | 4208785 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N-[4-[benzamido(phenyl)carbamoyl]phenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(C(=O)N(NC(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H35N3O3/c1-2-3-4-5-6-7-14-19-28(34)31-26-22-20-25(21-23-26)30(36)33(27-17-12-9-13-18-27)32-29(35)24-15-10-8-11-16-24/h8-13,15-18,20-23H,2-7,14,19H2,1H3,(H,31,34)(H,32,35) |
| InChIKey | UZSPFKFNVZNLTO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|