C9H13ClN2O — CID 131848151
N',N'-dimethylbenzohydrazide;hydrochloride (PubChem CID 131848151) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is N',N'-dimethylbenzohydrazide;hydrochloride.
| Compound Name | N',N'-dimethylbenzohydrazide;hydrochloride |
|---|---|
| PubChem CID | 131848151 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | N',N'-dimethylbenzohydrazide;hydrochloride |
| SMILES | CN(C)NC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C9H12N2O.ClH/c1-11(2)10-9(12)8-6-4-3-5-7-8;/h3-7H,1-2H3,(H,10,12);1H |
| InChIKey | FHUFVDHCILIVKU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|