C31H24N4O6 — CID 175312357
1-N,1-N',3-N,3-N'-tetrabenzoylpropanedihydrazide (PubChem CID 175312357) has the molecular formula C31H24N4O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is 1-N,1-N',3-N,3-N'-tetrabenzoylpropanedihydrazide.
| Compound Name | 1-N,1-N',3-N,3-N'-tetrabenzoylpropanedihydrazide |
|---|---|
| PubChem CID | 175312357 |
| Molecular Formula | C31H24N4O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 1-N,1-N',3-N,3-N'-tetrabenzoylpropanedihydrazide |
| SMILES | O=C(NN(C(=O)CC(=O)N(NC(=O)c1ccccc1)C(=O)c1ccccc1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H24N4O6/c36-26(34(30(40)24-17-9-3-10-18-24)32-28(38)22-13-5-1-6-14-22)21-27(37)35(31(41)25-19-11-4-12-20-25)33-29(39)23-15-7-2-8-16-23/h1-20H,21H2,(H,32,38)(H,33,39) |
| InChIKey | FMDZXTCLVSZCKO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|