C18H24N3O+ — CID 2407829
butyl-[2-(2,2-diphenylhydrazinyl)-2-oxoethyl]azanium (PubChem CID 2407829) has the molecular formula C18H24N3O+ and a molecular weight of 298.41 g/mol. Its IUPAC name is butyl-[2-(2,2-diphenylhydrazinyl)-2-oxoethyl]azanium.
| Compound Name | butyl-[2-(2,2-diphenylhydrazinyl)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2407829 |
| Molecular Formula | C18H24N3O+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | butyl-[2-(2,2-diphenylhydrazinyl)-2-oxoethyl]azanium |
| SMILES | CCCC[NH2+]CC(=O)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O/c1-2-3-14-19-15-18(22)20-21(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,19H,2-3,14-15H2,1H3,(H,20,22)/p+1 |
| InChIKey | DRHQGLIAMFACPH-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|