C15H16N2OS — CID 57182310
N',N'-diphenyl-3-sulfanylpropanehydrazide (PubChem CID 57182310) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is N',N'-diphenyl-3-sulfanylpropanehydrazide.
| Compound Name | N',N'-diphenyl-3-sulfanylpropanehydrazide |
|---|---|
| PubChem CID | 57182310 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N',N'-diphenyl-3-sulfanylpropanehydrazide |
| SMILES | O=C(CCS)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2OS/c18-15(11-12-19)16-17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,19H,11-12H2,(H,16,18) |
| InChIKey | SEFYXKFTAIVGSG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|