C27H24N2O4 — CID 15434956
2-[5-[3-(2,2-diphenylhydrazinyl)-3-oxopropyl]naphthalen-1-yl]oxyacetic acid (PubChem CID 15434956) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[5-[3-(2,2-diphenylhydrazinyl)-3-oxopropyl]naphthalen-1-yl]oxyacetic acid.
| Compound Name | 2-[5-[3-(2,2-diphenylhydrazinyl)-3-oxopropyl]naphthalen-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 15434956 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[5-[3-(2,2-diphenylhydrazinyl)-3-oxopropyl]naphthalen-1-yl]oxyacetic acid |
| SMILES | O=C(O)COc1cccc2c(CCC(=O)NN(c3ccccc3)c3ccccc3)cccc12 |
| InChI | InChI=1S/C27H24N2O4/c30-26(28-29(21-10-3-1-4-11-21)22-12-5-2-6-13-22)18-17-20-9-7-15-24-23(20)14-8-16-25(24)33-19-27(31)32/h1-16H,17-19H2,(H,28,30)(H,31,32) |
| InChIKey | YLAGUHNWEAHGGU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|