C23H22O4S — CID 57256114
2-[5-[3-(2-phenylethylsulfinyl)prop-2-enyl]naphthalen-1-yl]oxyacetic acid (PubChem CID 57256114) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-[5-[3-(2-phenylethylsulfinyl)prop-2-enyl]naphthalen-1-yl]oxyacetic acid.
| Compound Name | 2-[5-[3-(2-phenylethylsulfinyl)prop-2-enyl]naphthalen-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 57256114 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[5-[3-(2-phenylethylsulfinyl)prop-2-enyl]naphthalen-1-yl]oxyacetic acid |
| SMILES | O=C(O)COc1cccc2c(CC=CS(=O)CCc3ccccc3)cccc12 |
| InChI | InChI=1S/C23H22O4S/c24-23(25)17-27-22-13-5-11-20-19(9-4-12-21(20)22)10-6-15-28(26)16-14-18-7-2-1-3-8-18/h1-9,11-13,15H,10,14,16-17H2,(H,24,25) |
| InChIKey | ACORXLOHOZGCHT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |