C24H23NO7S — CID 54429524
2-[2-[5-(carboxymethoxy)naphthalen-1-yl]ethyl-(2-phenylethenylsulfonyl)amino]acetic acid (PubChem CID 54429524) has the molecular formula C24H23NO7S and a molecular weight of 469.52 g/mol. Its IUPAC name is 2-[2-[5-(carboxymethoxy)naphthalen-1-yl]ethyl-(2-phenylethenylsulfonyl)amino]acetic acid.
| Compound Name | 2-[2-[5-(carboxymethoxy)naphthalen-1-yl]ethyl-(2-phenylethenylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 54429524 |
| Molecular Formula | C24H23NO7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 2-[2-[5-(carboxymethoxy)naphthalen-1-yl]ethyl-(2-phenylethenylsulfonyl)amino]acetic acid |
| SMILES | O=C(O)COc1cccc2c(CCN(CC(=O)O)S(=O)(=O)C=Cc3ccccc3)cccc12 |
| InChI | InChI=1S/C24H23NO7S/c26-23(27)16-25(33(30,31)15-13-18-6-2-1-3-7-18)14-12-19-8-4-10-21-20(19)9-5-11-22(21)32-17-24(28)29/h1-11,13,15H,12,14,16-17H2,(H,26,27)(H,28,29) |
| InChIKey | WGMPBILMAMKWMA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |