C20H18N2 — CID 150486079
1-(4-ethenylphenyl)-1,2-diphenylhydrazine (PubChem CID 150486079) has the molecular formula C20H18N2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(4-ethenylphenyl)-1,2-diphenylhydrazine.
| Compound Name | 1-(4-ethenylphenyl)-1,2-diphenylhydrazine |
|---|---|
| PubChem CID | 150486079 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-(4-ethenylphenyl)-1,2-diphenylhydrazine |
| SMILES | C=Cc1ccc(N(Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N2/c1-2-17-13-15-20(16-14-17)22(19-11-7-4-8-12-19)21-18-9-5-3-6-10-18/h2-16,21H,1H2 |
| InChIKey | HUUXSRHZIYCZBW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|