C21H20N2 — CID 175179305
1,2-diphenyl-1-[4-[(E)-prop-1-enyl]phenyl]hydrazine (PubChem CID 175179305) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 1,2-diphenyl-1-[4-[(E)-prop-1-enyl]phenyl]hydrazine.
| Compound Name | 1,2-diphenyl-1-[4-[(E)-prop-1-enyl]phenyl]hydrazine |
|---|---|
| PubChem CID | 175179305 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1,2-diphenyl-1-[4-[(E)-prop-1-enyl]phenyl]hydrazine |
| SMILES | C/C=C/c1ccc(N(Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2/c1-2-9-18-14-16-21(17-15-18)23(20-12-7-4-8-13-20)22-19-10-5-3-6-11-19/h2-17,22H,1H3/b9-2+ |
| InChIKey | ZJZASCLQXAWPSZ-XNWCZRBMSA-N |
| XLogP | 5.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|