C34H48N2 — CID 175105922
1-phenyl-1,2-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]hydrazine (PubChem CID 175105922) has the molecular formula C34H48N2 and a molecular weight of 484.77 g/mol. Its IUPAC name is 1-phenyl-1,2-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]hydrazine.
| Compound Name | 1-phenyl-1,2-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 175105922 |
| Molecular Formula | C34H48N2 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | 1-phenyl-1,2-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]hydrazine |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(NN(c2ccccc2)c2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H48N2/c1-31(2,3)24-33(7,8)26-16-20-28(21-17-26)35-36(29-14-12-11-13-15-29)30-22-18-27(19-23-30)34(9,10)25-32(4,5)6/h11-23,35H,24-25H2,1-10H3 |
| InChIKey | MDXPRVBPEQDZHC-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|