C24H35NO — CID 70632889
N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline (PubChem CID 70632889) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline.
| Compound Name | N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline |
|---|---|
| PubChem CID | 70632889 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline |
| SMILES | CCN(c1ccccc1)C(C)Oc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H35NO/c1-8-25(21-12-10-9-11-13-21)19(2)26-22-16-14-20(15-17-22)24(6,7)18-23(3,4)5/h9-17,19H,8,18H2,1-7H3 |
| InChIKey | OZINKHRNQLCNOA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|