About N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline
N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline (PubChem CID 70632889) has the molecular formula C24H35NO
and a molecular weight of 353.55 g/mol. Its IUPAC name is N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline.
Molecular Properties
| Compound Name | N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline |
| PubChem CID | 70632889 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline |
| SMILES | CCN(c1ccccc1)C(C)Oc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H35NO/c1-8-25(21-12-10-9-11-13-21)19(2)26-22-16-14-20(15-17-22)24(6,7)18-23(3,4)5/h9-17,19H,8,18H2,1-7H3 |
| InChIKey | OZINKHRNQLCNOA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline?
The IUPAC name of N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline (CID 70632889) is N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline.
What is the SMILES notation for N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline?
The canonical SMILES for N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline is CCN(c1ccccc1)C(C)Oc1ccc(C(C)(C)CC(C)(C)C)cc1.
What is the InChIKey of N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline?
The InChIKey is OZINKHRNQLCNOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35NO/c1-8-25(21-12-10-9-11-13-21)19(2)26-22-16-14-20(15-17-22)24(6,7)18-23(3,4)5/h9-17,19H,8,18H2,1-7H3.
What are the key properties of N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline?
N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline has a molecular weight of 353.55 g/mol, XLogP of 6.65, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[1-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]aniline is sourced from PubChem (CID 70632889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).