About anilino(carboxy)carbamic acid
anilino(carboxy)carbamic acid (PubChem CID 154327082) has the molecular formula C8H8N2O4
and a molecular weight of 196.16 g/mol. Its IUPAC name is anilino(carboxy)carbamic acid.
Molecular Properties
| Compound Name | anilino(carboxy)carbamic acid |
| PubChem CID | 154327082 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | anilino(carboxy)carbamic acid |
| SMILES | O=C(O)N(Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C8H8N2O4/c11-7(12)10(8(13)14)9-6-4-2-1-3-5-6/h1-5,9H,(H,11,12)(H,13,14) |
| InChIKey | ZICNREPZVSPUHP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze anilino(carboxy)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilino(carboxy)carbamic acid?
The IUPAC name of anilino(carboxy)carbamic acid (CID 154327082) is anilino(carboxy)carbamic acid.
What is the SMILES notation for anilino(carboxy)carbamic acid?
The canonical SMILES for anilino(carboxy)carbamic acid is O=C(O)N(Nc1ccccc1)C(=O)O.
What is the InChIKey of anilino(carboxy)carbamic acid?
The InChIKey is ZICNREPZVSPUHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O4/c11-7(12)10(8(13)14)9-6-4-2-1-3-5-6/h1-5,9H,(H,11,12)(H,13,14).
What are the key properties of anilino(carboxy)carbamic acid?
anilino(carboxy)carbamic acid has a molecular weight of 196.16 g/mol, XLogP of 1.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anilino(carboxy)carbamic acid is sourced from PubChem (CID 154327082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).